C30H31NO5 — CID 6280495
(3E,5E)-1-benzyl-3,5-bis[(3-ethoxy-4-hydroxyphenyl)methylidene]piperidin-4-one (PubChem CID 6280495) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is (3E,5E)-1-benzyl-3,5-bis[(3-ethoxy-4-hydroxyphenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-1-benzyl-3,5-bis[(3-ethoxy-4-hydroxyphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 6280495 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (3E,5E)-1-benzyl-3,5-bis[(3-ethoxy-4-hydroxyphenyl)methylidene]piperidin-4-one |
| SMILES | CCOc1cc(/C=C2\CN(Cc3ccccc3)C/C(=C\c3ccc(O)c(OCC)c3)C2=O)ccc1O |
| InChI | InChI=1S/C30H31NO5/c1-3-35-28-16-22(10-12-26(28)32)14-24-19-31(18-21-8-6-5-7-9-21)20-25(30(24)34)15-23-11-13-27(33)29(17-23)36-4-2/h5-17,32-33H,3-4,18-20H2,1-2H3/b24-14+,25-15+ |
| InChIKey | GANQFUVOSAQNKO-KOJZRSEWSA-N |
| XLogP | 5.45 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|