C20H20O4 — CID 9447281
(2E)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one (PubChem CID 9447281) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2E)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 9447281 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (2E)-2-[(3-ethoxy-4-hydroxyphenyl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one |
| SMILES | CCOc1cc(/C=C2\CCc3cc(OC)ccc3C2=O)ccc1O |
| InChI | InChI=1S/C20H20O4/c1-3-24-19-11-13(4-9-18(19)21)10-15-6-5-14-12-16(23-2)7-8-17(14)20(15)22/h4,7-12,21H,3,5-6H2,1-2H3/b15-10+ |
| InChIKey | UCHVODMLUKRLJA-XNTDXEJSSA-N |
| XLogP | 4.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|