C19H17BrO4 — CID 9447285
(2Z)-2-[(2-bromo-5-hydroxy-4-methoxyphenyl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one (PubChem CID 9447285) has the molecular formula C19H17BrO4 and a molecular weight of 389.25 g/mol. Its IUPAC name is (2Z)-2-[(2-bromo-5-hydroxy-4-methoxyphenyl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one.
| Compound Name | (2Z)-2-[(2-bromo-5-hydroxy-4-methoxyphenyl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 9447285 |
| Molecular Formula | C19H17BrO4 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | (2Z)-2-[(2-bromo-5-hydroxy-4-methoxyphenyl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one |
| SMILES | COc1ccc2c(c1)CC/C(=C/c1cc(O)c(OC)cc1Br)C2=O |
| InChI | InChI=1S/C19H17BrO4/c1-23-14-5-6-15-11(8-14)3-4-12(19(15)22)7-13-9-17(21)18(24-2)10-16(13)20/h5-10,21H,3-4H2,1-2H3/b12-7- |
| InChIKey | DJXSLICQWHRYJB-GHXNOFRVSA-N |
| XLogP | 4.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|