C34H30N2O6 — CID 139088081
3-[(E)-(6-methoxy-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]-1H-pyridin-2-one (PubChem CID 139088081) has the molecular formula C34H30N2O6 and a molecular weight of 562.62 g/mol. Its IUPAC name is 3-[(E)-(6-methoxy-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]-1H-pyridin-2-one.
| Compound Name | 3-[(E)-(6-methoxy-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 139088081 |
| Molecular Formula | C34H30N2O6 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 3-[(E)-(6-methoxy-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]-1H-pyridin-2-one |
| SMILES | COc1ccc2c(c1)CC/C(=C\c1ccc[nH]c1=O)C2=O.COc1ccc2c(c1)CC/C(=C\c1ccc[nH]c1=O)C2=O |
| InChI | InChI=1S/2C17H15NO3/c2*1-21-14-6-7-15-11(10-14)4-5-12(16(15)19)9-13-3-2-8-18-17(13)20/h2*2-3,6-10H,4-5H2,1H3,(H,18,20)/b2*12-9+ |
| InChIKey | OXZGXYMVIMGVBB-MTTRIGNLSA-N |
| XLogP | 5.19 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|