C22H18O2 — CID 134848209
(2E)-6-methoxy-2-(naphthalen-1-ylmethylidene)-3,4-dihydronaphthalen-1-one (PubChem CID 134848209) has the molecular formula C22H18O2 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2E)-6-methoxy-2-(naphthalen-1-ylmethylidene)-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-6-methoxy-2-(naphthalen-1-ylmethylidene)-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 134848209 |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (2E)-6-methoxy-2-(naphthalen-1-ylmethylidene)-3,4-dihydronaphthalen-1-one |
| SMILES | COc1ccc2c(c1)CC/C(=C\c1cccc3ccccc13)C2=O |
| InChI | InChI=1S/C22H18O2/c1-24-19-11-12-21-17(14-19)9-10-18(22(21)23)13-16-7-4-6-15-5-2-3-8-20(15)16/h2-8,11-14H,9-10H2,1H3/b18-13+ |
| InChIKey | VZNUVHJTOFQWME-QGOAFFKASA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|