C22H20FeO2+2 — CID 11210966
CID 11210966 (PubChem CID 11210966) has the molecular formula C22H20FeO2+2 and a molecular weight of 372.25 g/mol.
| Compound Name | CID 11210966 |
|---|---|
| PubChem CID | 11210966 |
| Molecular Formula | C22H20FeO2+2 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)CC/C(=C\[C]1[CH][CH][CH][CH]1)C2=O.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C17H15O2.C5H5.Fe/c1-19-15-8-9-16-13(11-15)6-7-14(17(16)18)10-12-4-2-3-5-12;1-2-4-5-3-1;/h2-5,8-11H,6-7H2,1H3;1-5H;/q;;+2/b14-10+;; |
| InChIKey | QKQQUGDFBKVONR-YZEJZXAXSA-N |
| XLogP | 4.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|