C16H13BrO2S — CID 5147496
2-[(5-bromothiophen-2-yl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one (PubChem CID 5147496) has the molecular formula C16H13BrO2S and a molecular weight of 349.25 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one.
| Compound Name | 2-[(5-bromothiophen-2-yl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 5147496 |
| Molecular Formula | C16H13BrO2S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one |
| SMILES | COc1ccc2c(c1)CCC(=Cc1ccc(Br)s1)C2=O |
| InChI | InChI=1S/C16H13BrO2S/c1-19-12-4-6-14-10(8-12)2-3-11(16(14)18)9-13-5-7-15(17)20-13/h4-9H,2-3H2,1H3 |
| InChIKey | LVLUIJULHPMVMY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|