C32H35NO — CID 2132450
(3E,5E)-1-benzyl-3,5-bis[(4-propan-2-ylphenyl)methylidene]piperidin-4-one (PubChem CID 2132450) has the molecular formula C32H35NO and a molecular weight of 449.64 g/mol. Its IUPAC name is (3E,5E)-1-benzyl-3,5-bis[(4-propan-2-ylphenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-1-benzyl-3,5-bis[(4-propan-2-ylphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 2132450 |
| Molecular Formula | C32H35NO |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | (3E,5E)-1-benzyl-3,5-bis[(4-propan-2-ylphenyl)methylidene]piperidin-4-one |
| SMILES | CC(C)c1ccc(/C=C2\CN(Cc3ccccc3)C/C(=C\c3ccc(C(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C32H35NO/c1-23(2)28-14-10-25(11-15-28)18-30-21-33(20-27-8-6-5-7-9-27)22-31(32(30)34)19-26-12-16-29(17-13-26)24(3)4/h5-19,23-24H,20-22H2,1-4H3/b30-18+,31-19+ |
| InChIKey | HWIJGHAHEVQVHH-GFTXTJKWSA-N |
| XLogP | 7.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|