C24H23NO3 — CID 1036469
(3E)-1-benzyl-3,5-bis[(5-methylfuran-2-yl)methylidene]piperidin-4-one (PubChem CID 1036469) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is (3E)-1-benzyl-3,5-bis[(5-methylfuran-2-yl)methylidene]piperidin-4-one.
| Compound Name | (3E)-1-benzyl-3,5-bis[(5-methylfuran-2-yl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 1036469 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (3E)-1-benzyl-3,5-bis[(5-methylfuran-2-yl)methylidene]piperidin-4-one |
| SMILES | Cc1ccc(C=C2CN(Cc3ccccc3)C/C(=C\c3ccc(C)o3)C2=O)o1 |
| InChI | InChI=1S/C24H23NO3/c1-17-8-10-22(27-17)12-20-15-25(14-19-6-4-3-5-7-19)16-21(24(20)26)13-23-11-9-18(2)28-23/h3-13H,14-16H2,1-2H3/b20-12+,21-13? |
| InChIKey | RBNINQASNNFITK-SERSATILSA-N |
| XLogP | 5.04 |
| TPSA | 46.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|