C20H18Cl3NO — CID 5468195
(3E,5E)-3,5-bis[(4-chlorophenyl)methylidene]-1-methylpiperidin-4-one;hydrochloride (PubChem CID 5468195) has the molecular formula C20H18Cl3NO and a molecular weight of 394.73 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(4-chlorophenyl)methylidene]-1-methylpiperidin-4-one;hydrochloride.
| Compound Name | (3E,5E)-3,5-bis[(4-chlorophenyl)methylidene]-1-methylpiperidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 5468195 |
| Molecular Formula | C20H18Cl3NO |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | (3E,5E)-3,5-bis[(4-chlorophenyl)methylidene]-1-methylpiperidin-4-one;hydrochloride |
| SMILES | CN1C/C(=C\c2ccc(Cl)cc2)C(=O)/C(=C/c2ccc(Cl)cc2)C1.Cl |
| InChI | InChI=1S/C20H17Cl2NO.ClH/c1-23-12-16(10-14-2-6-18(21)7-3-14)20(24)17(13-23)11-15-4-8-19(22)9-5-15;/h2-11H,12-13H2,1H3;1H/b16-10+,17-11+; |
| InChIKey | CLCJQXBEHIRFGW-UUHMWQSOSA-N |
| XLogP | 5.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|