C21H20FNO — CID 134814020
(3E,5E)-3-[(4-fluorophenyl)methylidene]-1-methyl-5-[(4-methylphenyl)methylidene]piperidin-4-one (PubChem CID 134814020) has the molecular formula C21H20FNO and a molecular weight of 321.40 g/mol. Its IUPAC name is (3E,5E)-3-[(4-fluorophenyl)methylidene]-1-methyl-5-[(4-methylphenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-3-[(4-fluorophenyl)methylidene]-1-methyl-5-[(4-methylphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 134814020 |
| Molecular Formula | C21H20FNO |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (3E,5E)-3-[(4-fluorophenyl)methylidene]-1-methyl-5-[(4-methylphenyl)methylidene]piperidin-4-one |
| SMILES | Cc1ccc(/C=C2\CN(C)C/C(=C\c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H20FNO/c1-15-3-5-16(6-4-15)11-18-13-23(2)14-19(21(18)24)12-17-7-9-20(22)10-8-17/h3-12H,13-14H2,1-2H3/b18-11+,19-12+ |
| InChIKey | HFZQGQJIBBGYQV-GDAWTGGTSA-N |
| XLogP | 4.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|