C26H31NO — CID 134096308
(3Z,5E)-1-methyl-3,5-bis[(4-propylphenyl)methylidene]piperidin-4-one (PubChem CID 134096308) has the molecular formula C26H31NO and a molecular weight of 373.54 g/mol. Its IUPAC name is (3Z,5E)-1-methyl-3,5-bis[(4-propylphenyl)methylidene]piperidin-4-one.
| Compound Name | (3Z,5E)-1-methyl-3,5-bis[(4-propylphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 134096308 |
| Molecular Formula | C26H31NO |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (3Z,5E)-1-methyl-3,5-bis[(4-propylphenyl)methylidene]piperidin-4-one |
| SMILES | CCCc1ccc(/C=C2/CN(C)C/C(=C\c3ccc(CCC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H31NO/c1-4-6-20-8-12-22(13-9-20)16-24-18-27(3)19-25(26(24)28)17-23-14-10-21(7-5-2)11-15-23/h8-17H,4-7,18-19H2,1-3H3/b24-16-,25-17+ |
| InChIKey | COMFKDVPVYSYJT-DRPBVWSQSA-N |
| XLogP | 5.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|