C28H31NO — CID 118107894
(3Z,5E)-3,5-bis[(4-propylphenyl)methylidene]-1-prop-2-ynylpiperidin-4-one (PubChem CID 118107894) has the molecular formula C28H31NO and a molecular weight of 397.56 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis[(4-propylphenyl)methylidene]-1-prop-2-ynylpiperidin-4-one.
| Compound Name | (3Z,5E)-3,5-bis[(4-propylphenyl)methylidene]-1-prop-2-ynylpiperidin-4-one |
|---|---|
| PubChem CID | 118107894 |
| Molecular Formula | C28H31NO |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | (3Z,5E)-3,5-bis[(4-propylphenyl)methylidene]-1-prop-2-ynylpiperidin-4-one |
| SMILES | C#CCN1C/C(=C/c2ccc(CCC)cc2)C(=O)/C(=C/c2ccc(CCC)cc2)C1 |
| InChI | InChI=1S/C28H31NO/c1-4-7-22-9-13-24(14-10-22)18-26-20-29(17-6-3)21-27(28(26)30)19-25-15-11-23(8-5-2)12-16-25/h3,9-16,18-19H,4-5,7-8,17,20-21H2,1-2H3/b26-18-,27-19+ |
| InChIKey | QXEHAZDUXNAYJY-SZNZDIFOSA-N |
| XLogP | 5.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|