C22H19NO5 — CID 92857571
4-[(Z)-[(5Z)-5-[(4-carboxyphenyl)methylidene]-1-methyl-4-oxopiperidin-3-ylidene]methyl]benzoic acid (PubChem CID 92857571) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 4-[(Z)-[(5Z)-5-[(4-carboxyphenyl)methylidene]-1-methyl-4-oxopiperidin-3-ylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[(5Z)-5-[(4-carboxyphenyl)methylidene]-1-methyl-4-oxopiperidin-3-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 92857571 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 4-[(Z)-[(5Z)-5-[(4-carboxyphenyl)methylidene]-1-methyl-4-oxopiperidin-3-ylidene]methyl]benzoic acid |
| SMILES | CN1C/C(=C/c2ccc(C(=O)O)cc2)C(=O)/C(=C\c2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C22H19NO5/c1-23-12-18(10-14-2-6-16(7-3-14)21(25)26)20(24)19(13-23)11-15-4-8-17(9-5-15)22(27)28/h2-11H,12-13H2,1H3,(H,25,26)(H,27,28)/b18-10-,19-11- |
| InChIKey | XGQLCAXJLKEWEU-BJPQZVBLSA-N |
| XLogP | 3.06 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|