C32H43NO3 — CID 75409675
(3Z,5Z)-3,5-bis[(4-hexoxyphenyl)methylidene]-1-methylpiperidin-4-one (PubChem CID 75409675) has the molecular formula C32H43NO3 and a molecular weight of 489.70 g/mol. Its IUPAC name is (3Z,5Z)-3,5-bis[(4-hexoxyphenyl)methylidene]-1-methylpiperidin-4-one.
| Compound Name | (3Z,5Z)-3,5-bis[(4-hexoxyphenyl)methylidene]-1-methylpiperidin-4-one |
|---|---|
| PubChem CID | 75409675 |
| Molecular Formula | C32H43NO3 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | (3Z,5Z)-3,5-bis[(4-hexoxyphenyl)methylidene]-1-methylpiperidin-4-one |
| SMILES | CCCCCCOc1ccc(/C=C2/CN(C)C/C(=C/c3ccc(OCCCCCC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C32H43NO3/c1-4-6-8-10-20-35-30-16-12-26(13-17-30)22-28-24-33(3)25-29(32(28)34)23-27-14-18-31(19-15-27)36-21-11-9-7-5-2/h12-19,22-23H,4-11,20-21,24-25H2,1-3H3/b28-22-,29-23- |
| InChIKey | BLMHVKMMLYTUDV-UNVYMFJTSA-N |
| XLogP | 7.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|