C25H38O3 — CID 98152673
(3Z,5S)-3-[(4-nonoxyphenyl)methylidene]-5-pentyloxolan-2-one (PubChem CID 98152673) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (3Z,5S)-3-[(4-nonoxyphenyl)methylidene]-5-pentyloxolan-2-one.
| Compound Name | (3Z,5S)-3-[(4-nonoxyphenyl)methylidene]-5-pentyloxolan-2-one |
|---|---|
| PubChem CID | 98152673 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (3Z,5S)-3-[(4-nonoxyphenyl)methylidene]-5-pentyloxolan-2-one |
| SMILES | CCCCCCCCCOc1ccc(/C=C2/C[C@H](CCCCC)OC2=O)cc1 |
| InChI | InChI=1S/C25H38O3/c1-3-5-7-8-9-10-12-18-27-23-16-14-21(15-17-23)19-22-20-24(28-25(22)26)13-11-6-4-2/h14-17,19,24H,3-13,18,20H2,1-2H3/b22-19-/t24-/m0/s1 |
| InChIKey | CNHBNUVSBSVBPO-SFPLQAFVSA-N |
| XLogP | 7.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|