C32H36O2 — CID 102385092
(2E,5R)-2-[[4-[4-(4-hexoxyphenyl)phenyl]phenyl]methylidene]-5-methylcyclohexan-1-one (PubChem CID 102385092) has the molecular formula C32H36O2 and a molecular weight of 452.64 g/mol. Its IUPAC name is (2E,5R)-2-[[4-[4-(4-hexoxyphenyl)phenyl]phenyl]methylidene]-5-methylcyclohexan-1-one.
| Compound Name | (2E,5R)-2-[[4-[4-(4-hexoxyphenyl)phenyl]phenyl]methylidene]-5-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 102385092 |
| Molecular Formula | C32H36O2 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | (2E,5R)-2-[[4-[4-(4-hexoxyphenyl)phenyl]phenyl]methylidene]-5-methylcyclohexan-1-one |
| SMILES | CCCCCCOc1ccc(-c2ccc(-c3ccc(/C=C4\CC[C@@H](C)CC4=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H36O2/c1-3-4-5-6-21-34-31-19-17-29(18-20-31)28-15-13-27(14-16-28)26-11-8-25(9-12-26)23-30-10-7-24(2)22-32(30)33/h8-9,11-20,23-24H,3-7,10,21-22H2,1-2H3/b30-23+/t24-/m1/s1 |
| InChIKey | VDBMVGUMXIMZPN-QICKNKRUSA-N |
| XLogP | 8.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|