C29H38O2 — CID 101003085
cis-(3R,6R)-3-methyl-2-[(E)-2-[4-(4-pentoxyphenyl)phenyl]ethenyl]-6-propan-2-ylcyclohexan-1-one (PubChem CID 101003085) has the molecular formula C29H38O2 and a molecular weight of 418.62 g/mol. Its IUPAC name is cis-(3R,6R)-3-methyl-2-[(E)-2-[4-(4-pentoxyphenyl)phenyl]ethenyl]-6-propan-2-ylcyclohexan-1-one.
| Compound Name | cis-(3R,6R)-3-methyl-2-[(E)-2-[4-(4-pentoxyphenyl)phenyl]ethenyl]-6-propan-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 101003085 |
| Molecular Formula | C29H38O2 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | cis-(3R,6R)-3-methyl-2-[(E)-2-[4-(4-pentoxyphenyl)phenyl]ethenyl]-6-propan-2-ylcyclohexan-1-one |
| SMILES | CCCCCOc1ccc(-c2ccc(/C=C/C3C(=O)[C@@H](C(C)C)CC[C@H]3C)cc2)cc1 |
| InChI | InChI=1S/C29H38O2/c1-5-6-7-20-31-26-16-14-25(15-17-26)24-12-9-23(10-13-24)11-19-28-22(4)8-18-27(21(2)3)29(28)30/h9-17,19,21-22,27-28H,5-8,18,20H2,1-4H3/b19-11+/t22-,27-,28?/m1/s1 |
| InChIKey | MGIPSINXVBGWLR-MVBZTQEESA-N |
| XLogP | 7.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|