C18H28N2O — CID 124676704
(5R)-5-methyl-2-(4-octoxyphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 124676704) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is (5R)-5-methyl-2-(4-octoxyphenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | (5R)-5-methyl-2-(4-octoxyphenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 124676704 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | (5R)-5-methyl-2-(4-octoxyphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | CCCCCCCCOc1ccc(C2=NC[C@@H](C)N2)cc1 |
| InChI | InChI=1S/C18H28N2O/c1-3-4-5-6-7-8-13-21-17-11-9-16(10-12-17)18-19-14-15(2)20-18/h9-12,15H,3-8,13-14H2,1-2H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | NSDPJMVLOOOXAX-OAHLLOKOSA-N |
| XLogP | 4.16 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|