C40H40O4 — CID 122368079
2,7-bis[(E)-2-(4-pentoxyphenyl)ethenyl]anthracene-9,10-dione (PubChem CID 122368079) has the molecular formula C40H40O4 and a molecular weight of 584.76 g/mol. Its IUPAC name is 2,7-bis[(E)-2-(4-pentoxyphenyl)ethenyl]anthracene-9,10-dione.
| Compound Name | 2,7-bis[(E)-2-(4-pentoxyphenyl)ethenyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 122368079 |
| Molecular Formula | C40H40O4 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 2,7-bis[(E)-2-(4-pentoxyphenyl)ethenyl]anthracene-9,10-dione |
| SMILES | CCCCCOc1ccc(/C=C/c2ccc3c(c2)C(=O)c2cc(/C=C/c4ccc(OCCCCC)cc4)ccc2C3=O)cc1 |
| InChI | InChI=1S/C40H40O4/c1-3-5-7-25-43-33-19-13-29(14-20-33)9-11-31-17-23-35-37(27-31)40(42)38-28-32(18-24-36(38)39(35)41)12-10-30-15-21-34(22-16-30)44-26-8-6-4-2/h9-24,27-28H,3-8,25-26H2,1-2H3/b11-9+,12-10+ |
| InChIKey | WKPKNKUKNPGBET-WGDLNXRISA-N |
| XLogP | 9.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|