C25H28N2O4 — CID 67601643
(3Z,6Z)-3-[(4-hexoxyphenyl)methylidene]-6-[(4-methoxyphenyl)methylidene]piperazine-2,5-dione (PubChem CID 67601643) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (3Z,6Z)-3-[(4-hexoxyphenyl)methylidene]-6-[(4-methoxyphenyl)methylidene]piperazine-2,5-dione.
| Compound Name | (3Z,6Z)-3-[(4-hexoxyphenyl)methylidene]-6-[(4-methoxyphenyl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 67601643 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (3Z,6Z)-3-[(4-hexoxyphenyl)methylidene]-6-[(4-methoxyphenyl)methylidene]piperazine-2,5-dione |
| SMILES | CCCCCCOc1ccc(/C=c2\[nH]c(=O)/c(=C/c3ccc(OC)cc3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-3-4-5-6-15-31-21-13-9-19(10-14-21)17-23-25(29)26-22(24(28)27-23)16-18-7-11-20(30-2)12-8-18/h7-14,16-17H,3-6,15H2,1-2H3,(H,26,29)(H,27,28)/b22-16-,23-17- |
| InChIKey | OOGURPNXXTZBPB-IDUDEYGOSA-N |
| XLogP | 2.69 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|