C20H27NO4 — CID 70296275
(5E)-5-[(4-decoxyphenyl)methylidene]-1,3-oxazolidine-2,4-dione (PubChem CID 70296275) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (5E)-5-[(4-decoxyphenyl)methylidene]-1,3-oxazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4-decoxyphenyl)methylidene]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 70296275 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (5E)-5-[(4-decoxyphenyl)methylidene]-1,3-oxazolidine-2,4-dione |
| SMILES | CCCCCCCCCCOc1ccc(/C=C2/OC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C20H27NO4/c1-2-3-4-5-6-7-8-9-14-24-17-12-10-16(11-13-17)15-18-19(22)21-20(23)25-18/h10-13,15H,2-9,14H2,1H3,(H,21,22,23)/b18-15+ |
| InChIKey | AXFVFQUOICGXQJ-OBGWFSINSA-N |
| XLogP | 4.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|