C30H40O2 — CID 10993745
(3E,5R)-3-[[4-(4-heptylphenyl)phenyl]methylidene]-5-hexyloxolan-2-one (PubChem CID 10993745) has the molecular formula C30H40O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is (3E,5R)-3-[[4-(4-heptylphenyl)phenyl]methylidene]-5-hexyloxolan-2-one.
| Compound Name | (3E,5R)-3-[[4-(4-heptylphenyl)phenyl]methylidene]-5-hexyloxolan-2-one |
|---|---|
| PubChem CID | 10993745 |
| Molecular Formula | C30H40O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | (3E,5R)-3-[[4-(4-heptylphenyl)phenyl]methylidene]-5-hexyloxolan-2-one |
| SMILES | CCCCCCCc1ccc(-c2ccc(/C=C3\C[C@@H](CCCCCC)OC3=O)cc2)cc1 |
| InChI | InChI=1S/C30H40O2/c1-3-5-7-9-10-12-24-14-18-26(19-15-24)27-20-16-25(17-21-27)22-28-23-29(32-30(28)31)13-11-8-6-4-2/h14-22,29H,3-13,23H2,1-2H3/b28-22+/t29-/m1/s1 |
| InChIKey | JOPNKLYEWPAECU-OLGWKDBVSA-N |
| XLogP | 8.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|