C34H27NO3 — CID 134096311
(3E,5E)-3,5-bis[(4-benzoylphenyl)methylidene]-1-methylpiperidin-4-one (PubChem CID 134096311) has the molecular formula C34H27NO3 and a molecular weight of 497.59 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(4-benzoylphenyl)methylidene]-1-methylpiperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(4-benzoylphenyl)methylidene]-1-methylpiperidin-4-one |
|---|---|
| PubChem CID | 134096311 |
| Molecular Formula | C34H27NO3 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | (3E,5E)-3,5-bis[(4-benzoylphenyl)methylidene]-1-methylpiperidin-4-one |
| SMILES | CN1C/C(=C\c2ccc(C(=O)c3ccccc3)cc2)C(=O)/C(=C/c2ccc(C(=O)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C34H27NO3/c1-35-22-30(20-24-12-16-28(17-13-24)32(36)26-8-4-2-5-9-26)34(38)31(23-35)21-25-14-18-29(19-15-25)33(37)27-10-6-3-7-11-27/h2-21H,22-23H2,1H3/b30-20+,31-21+ |
| InChIKey | LAGSMKDBYDWJFK-OQIGUVFWSA-N |
| XLogP | 6.13 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|