C20H19NO — CID 6374106
(3Z,5E)-3,5-dibenzylidene-1-methylpiperidin-4-one (PubChem CID 6374106) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is (3Z,5E)-3,5-dibenzylidene-1-methylpiperidin-4-one.
| Compound Name | (3Z,5E)-3,5-dibenzylidene-1-methylpiperidin-4-one |
|---|---|
| PubChem CID | 6374106 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (3Z,5E)-3,5-dibenzylidene-1-methylpiperidin-4-one |
| SMILES | CN1C/C(=C/c2ccccc2)C(=O)/C(=C/c2ccccc2)C1 |
| InChI | InChI=1S/C20H19NO/c1-21-14-18(12-16-8-4-2-5-9-16)20(22)19(15-21)13-17-10-6-3-7-11-17/h2-13H,14-15H2,1H3/b18-12-,19-13+ |
| InChIKey | GHSYIDDDJZZVKM-MGYAYREDSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|