C46H36N2O4 — CID 70685306
(3E,5E)-3,5-dibenzylidene-1-[3-[(3E,5E)-3,5-dibenzylidene-4-oxopiperidine-1-carbonyl]benzoyl]piperidin-4-one (PubChem CID 70685306) has the molecular formula C46H36N2O4 and a molecular weight of 680.80 g/mol. Its IUPAC name is (3E,5E)-3,5-dibenzylidene-1-[3-[(3E,5E)-3,5-dibenzylidene-4-oxopiperidine-1-carbonyl]benzoyl]piperidin-4-one.
| Compound Name | (3E,5E)-3,5-dibenzylidene-1-[3-[(3E,5E)-3,5-dibenzylidene-4-oxopiperidine-1-carbonyl]benzoyl]piperidin-4-one |
|---|---|
| PubChem CID | 70685306 |
| Molecular Formula | C46H36N2O4 |
| Molecular Weight | 680.80 g/mol |
| Exact Mass | 680.27 |
| IUPAC Name | (3E,5E)-3,5-dibenzylidene-1-[3-[(3E,5E)-3,5-dibenzylidene-4-oxopiperidine-1-carbonyl]benzoyl]piperidin-4-one |
| SMILES | O=C1/C(=C/c2ccccc2)CN(C(=O)c2cccc(C(=O)N3C/C(=C\c4ccccc4)C(=O)/C(=C/c4ccccc4)C3)c2)C/C1=C\c1ccccc1 |
| InChI | InChI=1S/C46H36N2O4/c49-43-39(24-33-14-5-1-6-15-33)29-47(30-40(43)25-34-16-7-2-8-17-34)45(51)37-22-13-23-38(28-37)46(52)48-31-41(26-35-18-9-3-10-19-35)44(50)42(32-48)27-36-20-11-4-12-21-36/h1-28H,29-32H2/b39-24+,40-25+,41-26+,42-27+ |
| InChIKey | KQRDMXZSXCXAAZ-VFJYAMTASA-N |
| XLogP | 8.07 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.80 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|