C30H27NO2S2 — CID 166176861
phenacyl (3E,5E)-3,5-bis[(3-methylphenyl)methylidene]-4-oxopiperidine-1-carbodithioate (PubChem CID 166176861) has the molecular formula C30H27NO2S2 and a molecular weight of 497.69 g/mol. Its IUPAC name is phenacyl (3E,5E)-3,5-bis[(3-methylphenyl)methylidene]-4-oxopiperidine-1-carbodithioate.
| Compound Name | phenacyl (3E,5E)-3,5-bis[(3-methylphenyl)methylidene]-4-oxopiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 166176861 |
| Molecular Formula | C30H27NO2S2 |
| Molecular Weight | 497.69 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | phenacyl (3E,5E)-3,5-bis[(3-methylphenyl)methylidene]-4-oxopiperidine-1-carbodithioate |
| SMILES | Cc1cccc(/C=C2\CN(C(=S)SCC(=O)c3ccccc3)C/C(=C\c3cccc(C)c3)C2=O)c1 |
| InChI | InChI=1S/C30H27NO2S2/c1-21-8-6-10-23(14-21)16-26-18-31(30(34)35-20-28(32)25-12-4-3-5-13-25)19-27(29(26)33)17-24-11-7-9-22(2)15-24/h3-17H,18-20H2,1-2H3/b26-16+,27-17+ |
| InChIKey | XBQWULANCQWQLQ-CTVDDJEBSA-N |
| XLogP | 6.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.69 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|