C31H29Br2NO6 — CID 53364005
(3E,5E)-3,5-bis[[3-bromo-4-(methoxymethoxy)phenyl]methylidene]-1-phenacylpiperidin-4-one (PubChem CID 53364005) has the molecular formula C31H29Br2NO6 and a molecular weight of 671.38 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[[3-bromo-4-(methoxymethoxy)phenyl]methylidene]-1-phenacylpiperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[[3-bromo-4-(methoxymethoxy)phenyl]methylidene]-1-phenacylpiperidin-4-one |
|---|---|
| PubChem CID | 53364005 |
| Molecular Formula | C31H29Br2NO6 |
| Molecular Weight | 671.38 g/mol |
| Exact Mass | 669.04 |
| IUPAC Name | (3E,5E)-3,5-bis[[3-bromo-4-(methoxymethoxy)phenyl]methylidene]-1-phenacylpiperidin-4-one |
| SMILES | COCOc1ccc(/C=C2\CN(CC(=O)c3ccccc3)C/C(=C\c3ccc(OCOC)c(Br)c3)C2=O)cc1Br |
| InChI | InChI=1S/C31H29Br2NO6/c1-37-19-39-29-10-8-21(14-26(29)32)12-24-16-34(18-28(35)23-6-4-3-5-7-23)17-25(31(24)36)13-22-9-11-30(27(33)15-22)40-20-38-2/h3-15H,16-20H2,1-2H3/b24-12+,25-13+ |
| InChIKey | PFFWLCBTIVYAJC-DWGHPKEWSA-N |
| XLogP | 6.41 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.38 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|