C21H19Br3O5 — CID 24827801
(1E,4E)-1-[3-bromo-4-(methoxymethoxy)phenyl]-5-[3,5-dibromo-4-(methoxymethoxy)phenyl]penta-1,4-dien-3-one (PubChem CID 24827801) has the molecular formula C21H19Br3O5 and a molecular weight of 591.09 g/mol. Its IUPAC name is (1E,4E)-1-[3-bromo-4-(methoxymethoxy)phenyl]-5-[3,5-dibromo-4-(methoxymethoxy)phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[3-bromo-4-(methoxymethoxy)phenyl]-5-[3,5-dibromo-4-(methoxymethoxy)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 24827801 |
| Molecular Formula | C21H19Br3O5 |
| Molecular Weight | 591.09 g/mol |
| Exact Mass | 587.88 |
| IUPAC Name | (1E,4E)-1-[3-bromo-4-(methoxymethoxy)phenyl]-5-[3,5-dibromo-4-(methoxymethoxy)phenyl]penta-1,4-dien-3-one |
| SMILES | COCOc1ccc(/C=C/C(=O)/C=C/c2cc(Br)c(OCOC)c(Br)c2)cc1Br |
| InChI | InChI=1S/C21H19Br3O5/c1-26-12-28-20-8-5-14(9-17(20)22)3-6-16(25)7-4-15-10-18(23)21(19(24)11-15)29-13-27-2/h3-11H,12-13H2,1-2H3/b6-3+,7-4+ |
| InChIKey | KIFYEAJGHWAKFD-XOKGJFMYSA-N |
| XLogP | 6.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.09 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|