C23H18Br2O3S — CID 123684373
S-phenyl 3-[2-[3,5-dibromo-4-(methoxymethoxy)phenyl]ethenyl]benzenecarbothioate (PubChem CID 123684373) has the molecular formula C23H18Br2O3S and a molecular weight of 534.27 g/mol. Its IUPAC name is S-phenyl 3-[2-[3,5-dibromo-4-(methoxymethoxy)phenyl]ethenyl]benzenecarbothioate.
| Compound Name | S-phenyl 3-[2-[3,5-dibromo-4-(methoxymethoxy)phenyl]ethenyl]benzenecarbothioate |
|---|---|
| PubChem CID | 123684373 |
| Molecular Formula | C23H18Br2O3S |
| Molecular Weight | 534.27 g/mol |
| Exact Mass | 531.93 |
| IUPAC Name | S-phenyl 3-[2-[3,5-dibromo-4-(methoxymethoxy)phenyl]ethenyl]benzenecarbothioate |
| SMILES | COCOc1c(Br)cc(C=Cc2cccc(C(=O)Sc3ccccc3)c2)cc1Br |
| InChI | InChI=1S/C23H18Br2O3S/c1-27-15-28-22-20(24)13-17(14-21(22)25)11-10-16-6-5-7-18(12-16)23(26)29-19-8-3-2-4-9-19/h2-14H,15H2,1H3 |
| InChIKey | AZUPEZVYLCGHOF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.27 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|