C14H10Br2O2 — CID 60593987
2-(2,6-dibromophenoxy)-1-phenylethanone (PubChem CID 60593987) has the molecular formula C14H10Br2O2 and a molecular weight of 370.04 g/mol. Its IUPAC name is 2-(2,6-dibromophenoxy)-1-phenylethanone.
| Compound Name | 2-(2,6-dibromophenoxy)-1-phenylethanone |
|---|---|
| PubChem CID | 60593987 |
| Molecular Formula | C14H10Br2O2 |
| Molecular Weight | 370.04 g/mol |
| Exact Mass | 367.90 |
| IUPAC Name | 2-(2,6-dibromophenoxy)-1-phenylethanone |
| SMILES | O=C(COc1c(Br)cccc1Br)c1ccccc1 |
| InChI | InChI=1S/C14H10Br2O2/c15-11-7-4-8-12(16)14(11)18-9-13(17)10-5-2-1-3-6-10/h1-8H,9H2 |
| InChIKey | XWWKROWFAGJBGH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.04 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |