C15H12Br2O2 — CID 8914654
2-(2,6-dibromo-4-methylphenoxy)-1-phenylethanone (PubChem CID 8914654) has the molecular formula C15H12Br2O2 and a molecular weight of 384.07 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-methylphenoxy)-1-phenylethanone.
| Compound Name | 2-(2,6-dibromo-4-methylphenoxy)-1-phenylethanone |
|---|---|
| PubChem CID | 8914654 |
| Molecular Formula | C15H12Br2O2 |
| Molecular Weight | 384.07 g/mol |
| Exact Mass | 381.92 |
| IUPAC Name | 2-(2,6-dibromo-4-methylphenoxy)-1-phenylethanone |
| SMILES | Cc1cc(Br)c(OCC(=O)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C15H12Br2O2/c1-10-7-12(16)15(13(17)8-10)19-9-14(18)11-5-3-2-4-6-11/h2-8H,9H2,1H3 |
| InChIKey | XPAKPBCWZWTGME-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.07 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |