C16H13Br2NO4 — CID 68978844
1,3-dibromo-2-(methoxymethoxy)-5-[(E)-2-(4-nitrophenyl)ethenyl]benzene (PubChem CID 68978844) has the molecular formula C16H13Br2NO4 and a molecular weight of 443.09 g/mol. Its IUPAC name is 1,3-dibromo-2-(methoxymethoxy)-5-[(E)-2-(4-nitrophenyl)ethenyl]benzene.
| Compound Name | 1,3-dibromo-2-(methoxymethoxy)-5-[(E)-2-(4-nitrophenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 68978844 |
| Molecular Formula | C16H13Br2NO4 |
| Molecular Weight | 443.09 g/mol |
| Exact Mass | 440.92 |
| IUPAC Name | 1,3-dibromo-2-(methoxymethoxy)-5-[(E)-2-(4-nitrophenyl)ethenyl]benzene |
| SMILES | COCOc1c(Br)cc(/C=C/c2ccc([N+](=O)[O-])cc2)cc1Br |
| InChI | InChI=1S/C16H13Br2NO4/c1-22-10-23-16-14(17)8-12(9-15(16)18)3-2-11-4-6-13(7-5-11)19(20)21/h2-9H,10H2,1H3/b3-2+ |
| InChIKey | MHXNPHNCWZCZCD-NSCUHMNNSA-N |
| XLogP | 5.27 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.09 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|