C13H16BrNO3 — CID 42255401
(E)-3-[3-bromo-4-[2-(dimethylazaniumyl)ethoxy]phenyl]prop-2-enoate (PubChem CID 42255401) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[2-(dimethylazaniumyl)ethoxy]phenyl]prop-2-enoate.
| Compound Name | (E)-3-[3-bromo-4-[2-(dimethylazaniumyl)ethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 42255401 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | (E)-3-[3-bromo-4-[2-(dimethylazaniumyl)ethoxy]phenyl]prop-2-enoate |
| SMILES | C[NH+](C)CCOc1ccc(/C=C/C(=O)[O-])cc1Br |
| InChI | InChI=1S/C13H16BrNO3/c1-15(2)7-8-18-12-5-3-10(9-11(12)14)4-6-13(16)17/h3-6,9H,7-8H2,1-2H3,(H,16,17)/b6-4+ |
| InChIKey | KZTHSVFEXJMSIL-GQCTYLIASA-N |
| XLogP | -0.26 |
| TPSA | 53.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|