C18H16BrClO4 — CID 146443613
(E)-1-(4-bromo-3-chloro-2-hydroxyphenyl)-3-[4-(methoxymethoxy)-3-methylphenyl]prop-2-en-1-one (PubChem CID 146443613) has the molecular formula C18H16BrClO4 and a molecular weight of 411.68 g/mol. Its IUPAC name is (E)-1-(4-bromo-3-chloro-2-hydroxyphenyl)-3-[4-(methoxymethoxy)-3-methylphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-3-chloro-2-hydroxyphenyl)-3-[4-(methoxymethoxy)-3-methylphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146443613 |
| Molecular Formula | C18H16BrClO4 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | (E)-1-(4-bromo-3-chloro-2-hydroxyphenyl)-3-[4-(methoxymethoxy)-3-methylphenyl]prop-2-en-1-one |
| SMILES | COCOc1ccc(/C=C/C(=O)c2ccc(Br)c(Cl)c2O)cc1C |
| InChI | InChI=1S/C18H16BrClO4/c1-11-9-12(4-8-16(11)24-10-23-2)3-7-15(21)13-5-6-14(19)17(20)18(13)22/h3-9,22H,10H2,1-2H3/b7-3+ |
| InChIKey | VJWNHTOOACRAFS-XVNBXDOJSA-N |
| XLogP | 5.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|