C21H20F2O5 — CID 24828740
(1E,4E)-1,5-bis[3-fluoro-4-(methoxymethoxy)phenyl]penta-1,4-dien-3-one (PubChem CID 24828740) has the molecular formula C21H20F2O5 and a molecular weight of 390.38 g/mol. Its IUPAC name is (1E,4E)-1,5-bis[3-fluoro-4-(methoxymethoxy)phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis[3-fluoro-4-(methoxymethoxy)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 24828740 |
| Molecular Formula | C21H20F2O5 |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (1E,4E)-1,5-bis[3-fluoro-4-(methoxymethoxy)phenyl]penta-1,4-dien-3-one |
| SMILES | COCOc1ccc(/C=C/C(=O)/C=C/c2ccc(OCOC)c(F)c2)cc1F |
| InChI | InChI=1S/C21H20F2O5/c1-25-13-27-20-9-5-15(11-18(20)22)3-7-17(24)8-4-16-6-10-21(19(23)12-16)28-14-26-2/h3-12H,13-14H2,1-2H3/b7-3+,8-4+ |
| InChIKey | KYZZEEMJZRUJFI-FCXRPNKRSA-N |
| XLogP | 4.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|