C20H24O6 — CID 142209177
methyl (3Z,6E)-7-[3,4-bis(methoxymethoxy)phenyl]-2,5-dimethylidenehepta-3,6-dienoate (PubChem CID 142209177) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is methyl (3Z,6E)-7-[3,4-bis(methoxymethoxy)phenyl]-2,5-dimethylidenehepta-3,6-dienoate.
| Compound Name | methyl (3Z,6E)-7-[3,4-bis(methoxymethoxy)phenyl]-2,5-dimethylidenehepta-3,6-dienoate |
|---|---|
| PubChem CID | 142209177 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | methyl (3Z,6E)-7-[3,4-bis(methoxymethoxy)phenyl]-2,5-dimethylidenehepta-3,6-dienoate |
| SMILES | C=C(/C=C\C(=C)C(=O)OC)/C=C/c1ccc(OCOC)c(OCOC)c1 |
| InChI | InChI=1S/C20H24O6/c1-15(6-8-16(2)20(21)24-5)7-9-17-10-11-18(25-13-22-3)19(12-17)26-14-23-4/h6-12H,1-2,13-14H2,3-5H3/b8-6-,9-7+ |
| InChIKey | ARGMSPNVPIZWMF-MKKAVFGOSA-N |
| XLogP | 3.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|