C26H36O8Si — CID 176849429
[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl] (E)-3-[3,4-bis(methoxymethoxy)phenyl]prop-2-enoate (PubChem CID 176849429) has the molecular formula C26H36O8Si and a molecular weight of 504.65 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl] (E)-3-[3,4-bis(methoxymethoxy)phenyl]prop-2-enoate.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl] (E)-3-[3,4-bis(methoxymethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 176849429 |
| Molecular Formula | C26H36O8Si |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl] (E)-3-[3,4-bis(methoxymethoxy)phenyl]prop-2-enoate |
| SMILES | COCOc1ccc(/C=C/C(=O)Oc2ccc(O[Si](C)(C)C(C)(C)C)c(OC)c2)cc1OCOC |
| InChI | InChI=1S/C26H36O8Si/c1-26(2,3)35(7,8)34-22-13-11-20(16-23(22)30-6)33-25(27)14-10-19-9-12-21(31-17-28-4)24(15-19)32-18-29-5/h9-16H,17-18H2,1-8H3/b14-10+ |
| InChIKey | IZOQXWQUTBRAKX-GXDHUFHOSA-N |
| XLogP | 5.66 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|