C19H29ClO4Si — CID 71623565
[(E,2S)-4-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-1-chlorobut-3-en-2-yl] acetate (PubChem CID 71623565) has the molecular formula C19H29ClO4Si and a molecular weight of 384.98 g/mol. Its IUPAC name is [(E,2S)-4-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-1-chlorobut-3-en-2-yl] acetate.
| Compound Name | [(E,2S)-4-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-1-chlorobut-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 71623565 |
| Molecular Formula | C19H29ClO4Si |
| Molecular Weight | 384.98 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [(E,2S)-4-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-1-chlorobut-3-en-2-yl] acetate |
| SMILES | COc1cc(/C=C/[C@@H](CCl)OC(C)=O)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H29ClO4Si/c1-14(21)23-16(13-20)10-8-15-9-11-17(18(12-15)22-5)24-25(6,7)19(2,3)4/h8-12,16H,13H2,1-7H3/b10-8+/t16-/m0/s1 |
| InChIKey | HHBHHRODIAYNDI-DZZUKKPASA-N |
| XLogP | 5.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.98 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|