C24H30O4Si — CID 59028477
(E)-5-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-1-phenylpent-4-ene-1,3-dione (PubChem CID 59028477) has the molecular formula C24H30O4Si and a molecular weight of 410.59 g/mol. Its IUPAC name is (E)-5-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-1-phenylpent-4-ene-1,3-dione.
| Compound Name | (E)-5-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-1-phenylpent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 59028477 |
| Molecular Formula | C24H30O4Si |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (E)-5-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-1-phenylpent-4-ene-1,3-dione |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)c2ccccc2)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H30O4Si/c1-24(2,3)29(5,6)28-22-15-13-18(16-23(22)27-4)12-14-20(25)17-21(26)19-10-8-7-9-11-19/h7-16H,17H2,1-6H3/b14-12+ |
| InChIKey | JENDVUWFJKGHFL-WYMLVPIESA-N |
| XLogP | 5.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|