C18H15IO4 — CID 68815465
(E)-5-(4-hydroxy-3-methoxyphenyl)-1-(4-iodophenyl)pent-4-ene-1,3-dione (PubChem CID 68815465) has the molecular formula C18H15IO4 and a molecular weight of 422.22 g/mol. Its IUPAC name is (E)-5-(4-hydroxy-3-methoxyphenyl)-1-(4-iodophenyl)pent-4-ene-1,3-dione.
| Compound Name | (E)-5-(4-hydroxy-3-methoxyphenyl)-1-(4-iodophenyl)pent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 68815465 |
| Molecular Formula | C18H15IO4 |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | (E)-5-(4-hydroxy-3-methoxyphenyl)-1-(4-iodophenyl)pent-4-ene-1,3-dione |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)c2ccc(I)cc2)ccc1O |
| InChI | InChI=1S/C18H15IO4/c1-23-18-10-12(3-9-16(18)21)2-8-15(20)11-17(22)13-4-6-14(19)7-5-13/h2-10,21H,11H2,1H3/b8-2+ |
| InChIKey | ZFYJMAUNODQLOM-KRXBUXKQSA-N |
| XLogP | 3.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|