C23H28O4 — CID 19173379
(4-tert-butylphenyl) (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate (PubChem CID 19173379) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (4-tert-butylphenyl) (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate.
| Compound Name | (4-tert-butylphenyl) (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19173379 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (4-tert-butylphenyl) (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(/C=C/C(=O)Oc2ccc(C(C)(C)C)cc2)cc1OC |
| InChI | InChI=1S/C23H28O4/c1-6-15-26-20-13-7-17(16-21(20)25-5)8-14-22(24)27-19-11-9-18(10-12-19)23(2,3)4/h7-14,16H,6,15H2,1-5H3/b14-8+ |
| InChIKey | XWHACBGGKDBPHE-RIYZIHGNSA-N |
| XLogP | 5.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|