C27H23NO6 — CID 19185021
[4-(1,3-dioxoisoindol-2-yl)phenyl] (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate (PubChem CID 19185021) has the molecular formula C27H23NO6 and a molecular weight of 457.48 g/mol. Its IUPAC name is [4-(1,3-dioxoisoindol-2-yl)phenyl] (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate.
| Compound Name | [4-(1,3-dioxoisoindol-2-yl)phenyl] (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19185021 |
| Molecular Formula | C27H23NO6 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [4-(1,3-dioxoisoindol-2-yl)phenyl] (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(/C=C/C(=O)Oc2ccc(N3C(=O)c4ccccc4C3=O)cc2)cc1OC |
| InChI | InChI=1S/C27H23NO6/c1-3-16-33-23-14-8-18(17-24(23)32-2)9-15-25(29)34-20-12-10-19(11-13-20)28-26(30)21-6-4-5-7-22(21)27(28)31/h4-15,17H,3,16H2,1-2H3/b15-9+ |
| InChIKey | IYMKTYZEZNNLRM-OQLLNIDSSA-N |
| XLogP | 4.90 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|