C13H15FO3S — CID 107692273
(E)-3-[4-(2-ethylsulfanylethoxy)-3-fluorophenyl]prop-2-enoic acid (PubChem CID 107692273) has the molecular formula C13H15FO3S and a molecular weight of 270.32 g/mol. Its IUPAC name is (E)-3-[4-(2-ethylsulfanylethoxy)-3-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2-ethylsulfanylethoxy)-3-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107692273 |
| Molecular Formula | C13H15FO3S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | (E)-3-[4-(2-ethylsulfanylethoxy)-3-fluorophenyl]prop-2-enoic acid |
| SMILES | CCSCCOc1ccc(/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C13H15FO3S/c1-2-18-8-7-17-12-5-3-10(9-11(12)14)4-6-13(15)16/h3-6,9H,2,7-8H2,1H3,(H,15,16)/b6-4+ |
| InChIKey | BHXSEFASGMUETC-GQCTYLIASA-N |
| XLogP | 3.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|