C16H11Cl3O3 — CID 7948022
(E)-3-(3-hydroxy-4-methoxyphenyl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one (PubChem CID 7948022) has the molecular formula C16H11Cl3O3 and a molecular weight of 357.62 g/mol. Its IUPAC name is (E)-3-(3-hydroxy-4-methoxyphenyl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-hydroxy-4-methoxyphenyl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7948022 |
| Molecular Formula | C16H11Cl3O3 |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | (E)-3-(3-hydroxy-4-methoxyphenyl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(Cl)c(Cl)c2Cl)cc1O |
| InChI | InChI=1S/C16H11Cl3O3/c1-22-14-7-3-9(8-13(14)21)2-6-12(20)10-4-5-11(17)16(19)15(10)18/h2-8,21H,1H3/b6-2+ |
| InChIKey | HYTMJPGRIPWDAA-QHHAFSJGSA-N |
| XLogP | 5.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|