C19H17Cl3O3 — CID 7948045
(E)-3-(4-methoxy-3-propoxyphenyl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one (PubChem CID 7948045) has the molecular formula C19H17Cl3O3 and a molecular weight of 399.70 g/mol. Its IUPAC name is (E)-3-(4-methoxy-3-propoxyphenyl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-methoxy-3-propoxyphenyl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7948045 |
| Molecular Formula | C19H17Cl3O3 |
| Molecular Weight | 399.70 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | (E)-3-(4-methoxy-3-propoxyphenyl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one |
| SMILES | CCCOc1cc(/C=C/C(=O)c2ccc(Cl)c(Cl)c2Cl)ccc1OC |
| InChI | InChI=1S/C19H17Cl3O3/c1-3-10-25-17-11-12(5-9-16(17)24-2)4-8-15(23)13-6-7-14(20)19(22)18(13)21/h4-9,11H,3,10H2,1-2H3/b8-4+ |
| InChIKey | JFQKNKQQUBWZEA-XBXARRHUSA-N |
| XLogP | 6.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|