C10H9NaO4 — CID 66849635
sodium (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 66849635) has the molecular formula C10H9NaO4 and a molecular weight of 216.17 g/mol. Its IUPAC name is sodium (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | sodium (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 66849635 |
| Molecular Formula | C10H9NaO4 |
| Molecular Weight | 216.17 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | sodium (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)[O-])cc1O.[Na+] |
| InChI | InChI=1S/C10H10O4.Na/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13;/h2-6,11H,1H3,(H,12,13);/q;+1/p-1/b5-3+; |
| InChIKey | DSGXMEGLIMXDNB-WGCWOXMQSA-M |
| XLogP | -2.83 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.17 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|