C21H19FO5 — CID 68553866
1-(4-fluoro-3-methoxyphenyl)-7-(3-hydroxy-4-methoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 68553866) has the molecular formula C21H19FO5 and a molecular weight of 370.38 g/mol. Its IUPAC name is 1-(4-fluoro-3-methoxyphenyl)-7-(3-hydroxy-4-methoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 1-(4-fluoro-3-methoxyphenyl)-7-(3-hydroxy-4-methoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 68553866 |
| Molecular Formula | C21H19FO5 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-(4-fluoro-3-methoxyphenyl)-7-(3-hydroxy-4-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1ccc(C=CC(=O)CC(=O)C=Cc2ccc(F)c(OC)c2)cc1O |
| InChI | InChI=1S/C21H19FO5/c1-26-20-10-6-14(11-19(20)25)3-7-16(23)13-17(24)8-4-15-5-9-18(22)21(12-15)27-2/h3-12,25H,13H2,1-2H3 |
| InChIKey | AEVIAIBJBRTXLK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|