C24H20O4 — CID 68550038
1-(3-hydroxy-4-methoxyphenyl)-7-naphthalen-2-ylhepta-1,6-diene-3,5-dione (PubChem CID 68550038) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-(3-hydroxy-4-methoxyphenyl)-7-naphthalen-2-ylhepta-1,6-diene-3,5-dione.
| Compound Name | 1-(3-hydroxy-4-methoxyphenyl)-7-naphthalen-2-ylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 68550038 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-(3-hydroxy-4-methoxyphenyl)-7-naphthalen-2-ylhepta-1,6-diene-3,5-dione |
| SMILES | COc1ccc(C=CC(=O)CC(=O)C=Cc2ccc3ccccc3c2)cc1O |
| InChI | InChI=1S/C24H20O4/c1-28-24-13-9-18(15-23(24)27)8-12-22(26)16-21(25)11-7-17-6-10-19-4-2-3-5-20(19)14-17/h2-15,27H,16H2,1H3 |
| InChIKey | AUPXURLNEOQIFK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|