C28H33NO7 — CID 51134282
ethyl 3-[(3Z,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxopiperidin-1-yl]propanoate (PubChem CID 51134282) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is ethyl 3-[(3Z,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxopiperidin-1-yl]propanoate.
| Compound Name | ethyl 3-[(3Z,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxopiperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 51134282 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | ethyl 3-[(3Z,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxopiperidin-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1C/C(=C/c2ccc(OC)c(OC)c2)C(=O)/C(=C/c2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C28H33NO7/c1-6-36-27(30)11-12-29-17-21(13-19-7-9-23(32-2)25(15-19)34-4)28(31)22(18-29)14-20-8-10-24(33-3)26(16-20)35-5/h7-10,13-16H,6,11-12,17-18H2,1-5H3/b21-13-,22-14+ |
| InChIKey | WVEZQEKMWUJPAX-VOKWCDJLSA-N |
| XLogP | 4.03 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|